CAS 898773-00-7
:1-[5-(1,3-dioxolan-2-yl)-2-thienyl]-2-propyl-pentan-1-one
Description:
1-[5-(1,3-Dioxolan-2-yl)-2-thienyl]-2-propyl-pentan-1-one, with the CAS number 898773-00-7, is a synthetic organic compound characterized by its unique molecular structure that includes a dioxolane ring and a thienyl group. This compound typically exhibits properties associated with ketones, such as being a liquid at room temperature and having a distinct odor. Its dioxolane moiety may impart certain polar characteristics, potentially affecting its solubility in various solvents. The presence of the thienyl group suggests potential reactivity and interactions typical of thiophene derivatives, which can influence its chemical behavior and applications. This compound may be of interest in fields such as medicinal chemistry or materials science, where its structural features could be leveraged for specific biological or physical properties. As with many synthetic compounds, safety data and handling precautions should be considered, as they can vary based on the compound's specific characteristics and intended use.
Formula:C15H22O3S
InChI:InChI=1/C15H22O3S/c1-3-5-11(6-4-2)14(16)12-7-8-13(19-12)15-17-9-10-18-15/h7-8,11,15H,3-6,9-10H2,1-2H3
SMILES:CCCC(CCC)C(=O)c1ccc(C2OCCO2)s1
Synonyms:- 1-(5-(1,3-Dioxolan-2-yl)thiophen-2-yl)-2-propylpentan-1-one
- 1-Pentanone, 1-[5-(1,3-dioxolan-2-yl)-2-thienyl]-2-propyl-
- 5-(1,3-DIOXOLAN-2-YL)-2-THIENYL 1-PROPYLBUTYL KETONE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.