CymitQuimica logo

CAS 898773-02-9

:

1-[5-(1,3-dioxolan-2-yl)-2-thienyl]-3,5,5-trimethyl-hexan-1-one

Description:
1-[5-(1,3-Dioxolan-2-yl)-2-thienyl]-3,5,5-trimethyl-hexan-1-one, with the CAS number 898773-02-9, is an organic compound characterized by its complex structure that includes a dioxolane ring and a thienyl group. This compound typically exhibits properties associated with ketones, such as being a liquid at room temperature and having a distinct odor. The presence of the dioxolane moiety suggests potential solubility in polar solvents, while the thienyl group may impart unique electronic properties and reactivity. The trimethyl-hexan-1-one backbone contributes to its hydrophobic characteristics, influencing its behavior in various chemical environments. This compound may be of interest in fields such as organic synthesis, materials science, or pharmaceuticals due to its structural features, which could facilitate specific interactions or applications. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C16H24O3S
InChI:InChI=1/C16H24O3S/c1-11(10-16(2,3)4)9-12(17)13-5-6-14(20-13)15-18-7-8-19-15/h5-6,11,15H,7-10H2,1-4H3
SMILES:CC(CC(=O)c1ccc(C2OCCO2)s1)CC(C)(C)C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.