CAS 898773-08-5
:[5-(1,3-dioxolan-2-yl)-2-thienyl]-(2-methoxyphenyl)methanone
Description:
The chemical substance known as [5-(1,3-dioxolan-2-yl)-2-thienyl]-(2-methoxyphenyl)methanone, with the CAS number 898773-08-5, is characterized by its complex molecular structure that includes a thienyl group, a methoxyphenyl moiety, and a dioxolane ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may influence its reactivity and interactions. The presence of the dioxolane ring suggests potential for participation in various chemical reactions, including nucleophilic attacks and ring-opening processes. Additionally, the thienyl and methoxyphenyl groups contribute to the compound's electronic properties, potentially affecting its solubility and stability in different solvents. Such compounds may be of interest in medicinal chemistry due to their potential biological activities, which could include anti-inflammatory or anticancer properties. Overall, the unique combination of functional groups in this substance makes it a candidate for further research in synthetic and pharmaceutical applications.
Formula:C15H14O4S
InChI:InChI=1/C15H14O4S/c1-17-11-5-3-2-4-10(11)14(16)12-6-7-13(20-12)15-18-8-9-19-15/h2-7,15H,8-9H2,1H3
SMILES:COc1ccccc1C(=O)c1ccc(C2OCCO2)s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.