CAS 898773-09-6

(3-chlorophenyl)-[2-(1-piperidylmethyl)phenyl]methanone

Description:

The chemical substance known as (3-chlorophenyl)-[2-(1-piperidylmethyl)phenyl]methanone, with the CAS number 898773-09-6, is a synthetic organic compound characterized by its complex structure, which includes a chlorophenyl group and a piperidylmethyl substituent. This compound typically exhibits properties associated with ketones, including a carbonyl functional group that contributes to its reactivity and potential biological activity. The presence of the piperidine ring suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The chlorophenyl moiety may enhance lipophilicity, influencing the compound's solubility and permeability. Additionally, the compound's structural features may confer specific pharmacological properties, which could be explored in drug development contexts. As with many synthetic compounds, its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other substances. Safety and handling precautions are essential when working with this compound, as with any chemical substance, to mitigate potential hazards.

Formula: C₁₉H₂₀ClNO

InChI: InChI=1/C19H20ClNO/c20-17-9-6-8-15(13-17)19(22)18-10-3-2-7-16(18)14-21-11-4-1-5-12-21/h2-3,6-10,13H,1,4-5,11-12,14H2

SMILES: C1CCN(CC1)Cc1ccccc1C(=O)c1cccc(c1)Cl

3′-Chloro-2-piperidinomethyl benzophenone

CAS: 898773-09-6

Formula: C₁₉H₂₀ClNO

Purity: 97.0%

Molecular weight: 313.83

Ref: 10-F205183