CAS 898773-12-1

(4-chlorophenyl)-[2-(1-piperidylmethyl)phenyl]methanone

Description:

(4-chlorophenyl)-[2-(1-piperidylmethyl)phenyl]methanone, identified by its CAS number 898773-12-1, is a synthetic organic compound characterized by its complex structure, which includes a ketone functional group and a piperidine moiety. This compound features a chlorinated phenyl ring, contributing to its potential biological activity and lipophilicity. The presence of the piperidyl group suggests possible interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure indicates that it may exhibit properties such as moderate to high solubility in organic solvents and potential reactivity due to the ketone group. Additionally, the compound's unique arrangement of functional groups may influence its pharmacokinetic and pharmacodynamic profiles, including absorption, distribution, metabolism, and excretion. Overall, (4-chlorophenyl)-[2-(1-piperidylmethyl)phenyl]methanone represents a class of compounds that could be explored for therapeutic applications, although specific biological activities would require further investigation through experimental studies.

Formula: C₁₉H₂₀ClNO

InChI: InChI=1/C19H20ClNO/c20-17-10-8-15(9-11-17)19(22)18-7-3-2-6-16(18)14-21-12-4-1-5-13-21/h2-3,6-11H,1,4-5,12-14H2

SMILES: C1CCN(CC1)Cc1ccccc1C(=O)c1ccc(cc1)Cl

4′-Chloro-2-piperidinomethyl benzophenone

CAS: 898773-12-1

Formula: C₁₉H₂₀ClNO

Purity: 97.0%

Molecular weight: 313.83

Ref: 10-F205184