CAS 898773-15-4

(3-fluorophenyl)-[2-(1-piperidylmethyl)phenyl]methanone

Description:

The chemical substance known as (3-fluorophenyl)-[2-(1-piperidylmethyl)phenyl]methanone, with the CAS number 898773-15-4, is a synthetic organic compound that features a complex structure characterized by the presence of a fluorinated aromatic ring and a piperidine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential lipophilicity due to its aromatic components. The presence of the fluorine atom can enhance the compound's metabolic stability and influence its biological activity. The piperidine ring contributes to its potential as a pharmacophore, making it of interest in medicinal chemistry for the development of therapeutic agents. The compound may exhibit various physical properties such as solubility in organic solvents and moderate stability under standard laboratory conditions. Its specific reactivity and interactions would depend on the functional groups present and the overall molecular conformation, making it a candidate for further investigation in drug discovery and development.

Formula: C₁₉H₂₀FNO

InChI: InChI=1/C19H20FNO/c20-17-9-6-8-15(13-17)19(22)18-10-3-2-7-16(18)14-21-11-4-1-5-12-21/h2-3,6-10,13H,1,4-5,11-12,14H2

SMILES: C1CCN(CC1)Cc1ccccc1C(=O)c1cccc(c1)F

3′-Fluoro-2-piperidinomethyl benzophenone

CAS: 898773-15-4

Formula: C₁₉H₂₀FNO

Purity: 97.0%

Molecular weight: 297.373

Ref: 10-F205185