CAS 898773-17-6

[5-(1,3-dioxolan-2-yl)-2-thienyl]-(o-tolyl)methanone

Description:

The chemical substance known as [5-(1,3-dioxolan-2-yl)-2-thienyl]-(o-tolyl)methanone, with the CAS number 898773-17-6, is a synthetic organic compound characterized by its unique structural features. It contains a thienyl group, which is a five-membered aromatic ring containing sulfur, and a dioxolane moiety, which is a cyclic ether with two oxygen atoms in the ring. The presence of the o-tolyl group, a methyl-substituted phenyl group, contributes to its aromatic character and may influence its reactivity and solubility. This compound is likely to exhibit properties typical of ketones, such as being a polar substance with potential applications in organic synthesis or as an intermediate in the production of pharmaceuticals or agrochemicals. Its specific reactivity and interactions would depend on the functional groups present, making it a candidate for various chemical transformations. Overall, the compound's unique structure suggests potential utility in research and development within the fields of medicinal chemistry and materials science.

Formula: C₁₅H₁₄O₃S

InChI: InChI=1/C15H14O3S/c1-10-4-2-3-5-11(10)14(16)12-6-7-13(19-12)15-17-8-9-18-15/h2-7,15H,8-9H2,1H3

SMILES: Cc1ccccc1C(=O)c1ccc(C2OCCO2)s1