CAS 898773-23-4

[5-(1,3-Dioxolan-2-yl)-2-thienyl](4-methylphenyl)methanone

Description:

The chemical substance known as [5-(1,3-Dioxolan-2-yl)-2-thienyl](4-methylphenyl)methanone, with the CAS number 898773-23-4, is an organic compound characterized by its complex structure that includes a thienyl ring, a dioxolane moiety, and a ketone functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may influence its reactivity and interactions. The presence of the dioxolane ring suggests potential for solubility in polar solvents, while the thienyl and methylphenyl groups may contribute to its hydrophobic characteristics. Such compounds often display interesting biological activities, making them of interest in pharmaceutical research. Additionally, the presence of multiple functional groups can lead to diverse chemical reactivity, including potential for electrophilic substitution and nucleophilic attack. Overall, this compound's unique structural features may lend it utility in various applications, including organic synthesis and medicinal chemistry.

Formula: C₁₅H₁₄O₃S

InChI: InChI=1S/C15H14O3S/c1-10-2-4-11(5-3-10)14(16)12-6-7-13(19-12)15-17-8-9-18-15/h2-7,15H,8-9H2,1H3

InChI key: InChIKey=KDLIRGPFTRMBAZ-UHFFFAOYSA-N

SMILES: C(=O)(C=1SC(=CC1)C2OCCO2)C3=CC=C(C)C=C3

Synonyms:

• [5-(1,3-Dioxolan-2-yl)-2-thienyl](4-methylphenyl)methanone
• Methanone, [5-(1,3-dioxolan-2-yl)-2-thienyl](4-methylphenyl)-