CAS 898773-24-5

Methanone, (2,4-dimethylphenyl)[2-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (2,4-dimethylphenyl)[2-(1-piperidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two distinct aromatic rings. The presence of the 2,4-dimethylphenyl group indicates that the compound has methyl substituents on the aromatic ring, which can influence its reactivity and physical properties. Additionally, the incorporation of a piperidinylmethyl group suggests potential interactions with biological systems, as piperidine derivatives are often associated with pharmacological activity. This compound may exhibit properties such as moderate solubility in organic solvents and potential stability under standard laboratory conditions. Its molecular structure may allow for various chemical reactions, including electrophilic substitutions or nucleophilic attacks, depending on the functional groups present. As with many organic compounds, safety and handling precautions should be observed, particularly in terms of toxicity and environmental impact, which are important considerations in both laboratory and industrial settings.

Formula: C₂₁H₂₅NO

InChI: InChI=1S/C21H25NO/c1-16-10-11-19(17(2)14-16)21(23)20-9-5-4-8-18(20)15-22-12-6-3-7-13-22/h4-5,8-11,14H,3,6-7,12-13,15H2,1-2H3

InChI key: InChIKey=LHXWQQOWFNYWTK-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=C(C)C=C(C)C=C2)C=CC=C1)N3CCCCC3

Synonyms:

• 2,4-Dimethyl-2′-piperidinomethyl benzophenone
• Methanone, (2,4-dimethylphenyl)[2-(1-piperidinylmethyl)phenyl]-
• (2,4-Dimethylphenyl)[2-(1-piperidinylmethyl)phenyl]methanone

2,4-Dimethyl-2′-piperidinomethyl benzophenone

CAS: 898773-24-5

Formula: C₂₁H₂₅NO

Purity: 97.0%

Molecular weight: 307.437

Ref: 10-F205188