CAS 898773-27-8

(2,5-dimethylphenyl)-[2-(1-piperidylmethyl)phenyl]methanone

Description:

The chemical substance known as (2,5-dimethylphenyl)-[2-(1-piperidylmethyl)phenyl]methanone, with the CAS number 898773-27-8, is a synthetic organic compound that belongs to the class of ketones. It features a complex structure characterized by a phenyl ring substituted with a dimethyl group and a piperidylmethyl group, which contributes to its potential biological activity. The presence of the piperidine moiety suggests possible interactions with biological targets, making it of interest in medicinal chemistry. This compound may exhibit properties such as lipophilicity due to its aromatic rings, which can influence its solubility and permeability in biological systems. Additionally, the presence of multiple functional groups may allow for various chemical reactions, making it a versatile compound in synthetic applications. Its specific applications and biological activities would depend on further research and characterization, including studies on its pharmacokinetics and pharmacodynamics. Overall, this compound represents a unique structure that could be explored for various chemical and pharmaceutical applications.

Formula: C₂₁H₂₅NO

InChI: InChI=1/C21H25NO/c1-16-10-11-17(2)20(14-16)21(23)19-9-5-4-8-18(19)15-22-12-6-3-7-13-22/h4-5,8-11,14H,3,6-7,12-13,15H2,1-2H3

SMILES: Cc1ccc(C)c(c1)C(=O)c1ccccc1CN1CCCCC1