CAS 898773-30-3

Methanone, (2,6-dimethylphenyl)[2-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (2,6-dimethylphenyl)[2-(1-piperidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two distinct aromatic rings. The presence of the 2,6-dimethylphenyl group indicates that the compound has methyl substituents on the aromatic ring, contributing to its hydrophobic character and potentially influencing its reactivity and solubility. The inclusion of a piperidinylmethyl group suggests that the compound may exhibit basic properties due to the nitrogen atom in the piperidine ring, which can participate in hydrogen bonding and affect the compound's interaction with biological systems. This compound may be of interest in medicinal chemistry, particularly for its potential pharmacological properties. Its molecular structure implies that it could interact with various biological targets, making it a candidate for further research in drug development. As with many organic compounds, its stability, reactivity, and biological activity would depend on environmental conditions and specific functional group interactions.

Formula: C₂₁H₂₅NO

InChI: InChI=1S/C21H25NO/c1-16-9-8-10-17(2)20(16)21(23)19-12-5-4-11-18(19)15-22-13-6-3-7-14-22/h4-5,8-12H,3,6-7,13-15H2,1-2H3

InChI key: InChIKey=CURHQLNSGHLEKH-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCCCC2)C=CC=C1)C3=C(C)C=CC=C3C

Synonyms:

• (2,6-Dimethylphenyl)[2-(1-piperidinylmethyl)phenyl]methanone
• Methanone, (2,6-dimethylphenyl)[2-(1-piperidinylmethyl)phenyl]-

2,6-Dimethyl-2′-piperidinomethyl benzophenone

CAS: 898773-30-3

Formula: C₂₁H₂₅NO

Purity: 97.0%

Molecular weight: 307.437

Ref: 10-F205190