CAS 898773-32-5

[5-(1,3-Dioxolan-2-yl)-2-thienyl][4-(trifluoromethyl)phenyl]methanone

Description:

The chemical substance known as [5-(1,3-Dioxolan-2-yl)-2-thienyl][4-(trifluoromethyl)phenyl]methanone, with the CAS number 898773-32-5, exhibits several notable characteristics. It is a synthetic organic compound that features a complex structure, incorporating a dioxolane ring, a thiophene moiety, and a trifluoromethyl-substituted phenyl group. This combination of functional groups suggests potential applications in pharmaceuticals or agrochemicals, particularly due to the presence of the trifluoromethyl group, which is known to enhance lipophilicity and metabolic stability. The dioxolane ring may contribute to the compound's solubility and reactivity, while the thiophene unit can impart electronic properties beneficial for various chemical interactions. The compound's molecular structure indicates it may exhibit interesting biological activity, although specific biological properties would require empirical investigation. Overall, this compound represents a unique scaffold that could be explored for its potential utility in various chemical and biological applications.

Formula: C₁₅H₁₁F₃O₃S

InChI: InChI=1S/C15H11F3O3S/c16-15(17,18)10-3-1-9(2-4-10)13(19)11-5-6-12(22-11)14-20-7-8-21-14/h1-6,14H,7-8H2

InChI key: InChIKey=KEEWWWVADGCIAA-UHFFFAOYSA-N

SMILES: C(=O)(C=1SC(=CC1)C2OCCO2)C3=CC=C(C(F)(F)F)C=C3

Synonyms:

• Methanone, [5-(1,3-dioxolan-2-yl)-2-thienyl][4-(trifluoromethyl)phenyl]-
• [5-(1,3-Dioxolan-2-yl)-2-thienyl][4-(trifluoromethyl)phenyl]methanone