CAS 898773-33-6

Methanone, (3,4-dimethylphenyl)[2-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (3,4-dimethylphenyl)[2-(1-piperidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two distinct aromatic rings. The presence of the 3,4-dimethylphenyl group indicates that the compound has methyl substituents on the aromatic ring, which can influence its physical and chemical properties, such as solubility and reactivity. The piperidinylmethyl group suggests that the compound may exhibit basic properties due to the nitrogen atom in the piperidine ring, potentially allowing for interactions with biological systems. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. Additionally, its molecular weight, melting point, and solubility characteristics would be relevant for practical applications, although specific values would need to be referenced from experimental data. Overall, the compound's unique structure positions it as a candidate for further investigation in various chemical and biological contexts.

Formula: C₂₁H₂₅NO

InChI: InChI=1S/C21H25NO/c1-16-10-11-18(14-17(16)2)21(23)20-9-5-4-8-19(20)15-22-12-6-3-7-13-22/h4-5,8-11,14H,3,6-7,12-13,15H2,1-2H3

InChI key: InChIKey=RYEVGRQTJLVVBB-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCCCC2)C=CC=C1)C3=CC(C)=C(C)C=C3

Synonyms:

• (3,4-Dimethylphenyl)[2-(1-piperidinylmethyl)phenyl]methanone
• Methanone, (3,4-dimethylphenyl)[2-(1-piperidinylmethyl)phenyl]-

3′,4′-Dimethyl-2-piperidinomethyl benzophenone

CAS: 898773-33-6

Formula: C₂₁H₂₅NO

Purity: 97.0%

Molecular weight: 307.437

Ref: 10-F205191