CAS 898773-35-8
:[5-(1,3-dioxolan-2-yl)-2-thienyl]-(2-fluorophenyl)methanone
Description:
The chemical substance known as [5-(1,3-dioxolan-2-yl)-2-thienyl]-(2-fluorophenyl)methanone, with the CAS number 898773-35-8, is characterized by its unique structural features that include a thienyl ring, a dioxolane moiety, and a fluorophenyl group. This compound typically exhibits properties associated with both heterocyclic and aromatic systems, which can influence its reactivity and interactions. The presence of the dioxolane ring suggests potential for participation in various chemical reactions, such as nucleophilic attacks or ring-opening processes. The fluorine atom in the phenyl group may enhance the compound's lipophilicity and alter its electronic properties, potentially affecting its biological activity. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, or materials science due to their diverse functional groups and structural complexity. Additionally, the compound's stability, solubility, and reactivity can be influenced by the specific arrangement of its substituents, making it a subject of interest in synthetic and medicinal chemistry.
Formula:C14H11FO3S
InChI:InChI=1/C14H11FO3S/c15-10-4-2-1-3-9(10)13(16)11-5-6-12(19-11)14-17-7-8-18-14/h1-6,14H,7-8H2
SMILES:c1ccc(c(c1)C(=O)c1ccc(C2OCCO2)s1)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.