CAS 898773-36-9

Methanone, (3,5-dimethylphenyl)[2-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (3,5-dimethylphenyl)[2-(1-piperidinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 3,5-dimethylphenyl group indicates that there are two methyl substituents on the phenyl ring, contributing to its hydrophobic characteristics. The compound also features a piperidinylmethyl group, which introduces a nitrogen-containing heterocycle, enhancing its potential for biological activity. This structure suggests that the compound may exhibit properties relevant to medicinal chemistry, possibly acting as a ligand for various biological targets. Its molecular interactions could be influenced by the steric and electronic effects of the substituents, making it a candidate for further investigation in drug development. Additionally, the compound's solubility, stability, and reactivity would depend on the specific arrangement of its functional groups and the overall molecular geometry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₂₁H₂₅NO

InChI: InChI=1S/C21H25NO/c1-16-12-17(2)14-19(13-16)21(23)20-9-5-4-8-18(20)15-22-10-6-3-7-11-22/h4-5,8-9,12-14H,3,6-7,10-11,15H2,1-2H3

InChI key: InChIKey=SWEYWFHWJRZZHS-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCCCC2)C=CC=C1)C3=CC(C)=CC(C)=C3

Synonyms:

• (3,5-Dimethylphenyl)[2-(1-piperidinylmethyl)phenyl]methanone
• Methanone, (3,5-dimethylphenyl)[2-(1-piperidinylmethyl)phenyl]-
• 3′,5′-Dimethyl-2-piperidinomethyl benzophenone

3',5'-Dimethyl-2-piperidinomethyl benzophenone

CAS: 898773-36-9

Purity: 97.0%

Molecular weight: 307.437

Ref: 10-F205192