CAS 898773-38-1
:[5-(1,3-dioxolan-2-yl)-2-thienyl]-(3-fluorophenyl)methanone
Description:
The chemical substance known as [5-(1,3-dioxolan-2-yl)-2-thienyl]-(3-fluorophenyl)methanone, with the CAS number 898773-38-1, is characterized by its unique structural features that combine a thienyl ring, a dioxolane moiety, and a fluorophenyl group. This compound typically exhibits properties associated with both heterocyclic and aromatic systems, which may influence its reactivity and interactions. The presence of the dioxolane ring suggests potential for participation in various chemical reactions, such as nucleophilic attacks or ring-opening processes. The fluorine atom in the phenyl group can enhance the compound's lipophilicity and may affect its biological activity, making it of interest in medicinal chemistry. Additionally, the overall molecular structure may confer specific electronic properties, influencing its absorption and emission characteristics in spectroscopic studies. Such compounds are often explored for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis.
Formula:C14H11FO3S
InChI:InChI=1/C14H11FO3S/c15-10-3-1-2-9(8-10)13(16)11-4-5-12(19-11)14-17-6-7-18-14/h1-5,8,14H,6-7H2
SMILES:c1cc(cc(c1)F)C(=O)c1ccc(C2OCCO2)s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.