CAS 898773-39-2

(4-bromo-3-fluoro-phenyl)-[2-(1-piperidylmethyl)phenyl]methanone

Description:

(4-bromo-3-fluoro-phenyl)-[2-(1-piperidylmethyl)phenyl]methanone, with the CAS number 898773-39-2, is a synthetic organic compound characterized by its complex structure, which includes a phenyl ring substituted with bromine and fluorine atoms, as well as a piperidine moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to its structural features, which may interact with biological targets. The presence of halogen substituents (bromine and fluorine) can influence its reactivity and lipophilicity, making it of interest in medicinal chemistry for the development of pharmaceuticals. Additionally, the piperidine group may contribute to its pharmacological properties, potentially enhancing its ability to cross biological membranes. As with many compounds in this class, safety and handling precautions are essential due to the potential toxicity associated with halogenated compounds. Overall, this substance may serve as a valuable lead compound in drug discovery and development processes.

Formula: C₁₉H₁₉BrFNO

InChI: InChI=1/C19H19BrFNO/c20-17-9-8-14(12-18(17)21)19(23)16-7-3-2-6-15(16)13-22-10-4-1-5-11-22/h2-3,6-9,12H,1,4-5,10-11,13H2

SMILES: C1CCN(CC1)Cc1ccccc1C(=O)c1ccc(c(c1)F)Br

4′-Bromo-3′-fluoro-2-piperidinomethyl benzophenone

CAS: 898773-39-2

Formula: C₁₉H₁₉BrFNO

Purity: 97.0%

Molecular weight: 376.269

Ref: 10-F205193