CAS 898773-42-7

Methanone, (4-chloro-3-fluorophenyl)[2-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (4-chloro-3-fluorophenyl)[2-(1-piperidinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a piperidine moiety suggests potential biological activity, as piperidine derivatives are often found in pharmaceuticals. The specific halogen substitutions, namely the chloro and fluoro groups, can significantly influence the compound's reactivity, lipophilicity, and overall pharmacological properties. This compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity may vary depending on the presence of functional groups and the overall electronic environment. Additionally, the molecular structure indicates potential for interactions with biological targets, making it of interest in medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of halogens, which can impart toxicity or environmental concerns. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical behavior in organic chemistry.

Formula: C₁₉H₁₉ClFNO

InChI: InChI=1/C19H19ClFNO/c20-17-9-8-14(12-18(17)21)19(23)16-7-3-2-6-15(16)13-22-10-4-1-5-11-22/h2-3,6-9,12H,1,4-5,10-11,13H2

InChI key: InChIKey=MMENGZHREUNMNM-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCCCC2)C=CC=C1)C3=CC(F)=C(Cl)C=C3

Synonyms:

• (4-Chloro-3-fluorophenyl)[2-(1-piperidinylmethyl)phenyl]methanone
• 4′-Chloro-3′-fluoro-2-piperidinomethyl benzophenone
• Methanone, (4-chloro-3-fluorophenyl)[2-(1-piperidinylmethyl)phenyl]-
• (4-Chloro-3-fluorophenyl)(2-(piperidin-1-ylmethyl)phenyl)methanone

4′-Chloro-3′-fluoro-2-piperidinomethyl benzophenone

CAS: 898773-42-7

Formula: C₁₉H₁₉ClFNO

Purity: 97.0%

Molecular weight: 331.82

Ref: 10-F205194