CAS 898773-48-3
:(2-fluorophenyl)-[2-(1-piperidylmethyl)phenyl]methanone
Description:
The chemical substance known as (2-fluorophenyl)-[2-(1-piperidylmethyl)phenyl]methanone, with the CAS number 898773-48-3, is a synthetic organic compound characterized by its complex structure, which includes a fluorinated phenyl group and a piperidylmethyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the fluorine atom can enhance lipophilicity and influence the compound's interaction with biological targets. As a ketone, it features a carbonyl group that may participate in various chemical reactions, including nucleophilic attacks. The piperidine ring adds to the compound's pharmacological profile, potentially affecting its binding affinity and selectivity for specific receptors or enzymes. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly in the context of designing new therapeutic agents with specific biological activities. However, detailed studies would be necessary to fully elucidate its properties and potential applications.
Formula:C19H20FNO
InChI:InChI=1/C19H20FNO/c20-18-11-5-4-10-17(18)19(22)16-9-3-2-8-15(16)14-21-12-6-1-7-13-21/h2-5,8-11H,1,6-7,12-14H2
SMILES:C1CCN(CC1)Cc1ccccc1C(=O)c1ccccc1F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.