CymitQuimica logo

CAS 898773-53-0

:

[2-(1-piperidylmethyl)phenyl]-[3-(trifluoromethyl)phenyl]methanone

Description:
The chemical substance known as [2-(1-piperidylmethyl)phenyl]-[3-(trifluoromethyl)phenyl]methanone, with the CAS number 898773-53-0, is a synthetic organic compound characterized by its complex structure that includes a piperidine ring and a trifluoromethyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the trifluoromethyl group often enhances lipophilicity and metabolic stability, which can influence the compound's pharmacokinetics. Additionally, the piperidine moiety may impart specific interactions with biological targets, making it of interest in medicinal chemistry. The compound is likely to be solid at room temperature and may have moderate solubility in organic solvents. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be evaluated for various applications, including as a potential pharmaceutical agent or in material science. Safety and handling precautions should be observed due to the presence of fluorinated groups, which can pose environmental and health risks.
Formula:C20H20F3NO
InChI:InChI=1/C20H20F3NO/c21-20(22,23)17-9-6-8-15(13-17)19(25)18-10-3-2-7-16(18)14-24-11-4-1-5-12-24/h2-3,6-10,13H,1,4-5,11-12,14H2
SMILES:C1CCN(CC1)Cc1ccccc1C(=O)c1cccc(c1)C(F)(F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.