CAS 898773-57-4

(4-bromo-2-fluoro-phenyl)-[2-(1-piperidylmethyl)phenyl]methanone

Description:

The chemical substance known as (4-bromo-2-fluoro-phenyl)-[2-(1-piperidylmethyl)phenyl]methanone, with the CAS number 898773-57-4, is a synthetic organic compound characterized by its complex structure, which includes a phenyl ring substituted with bromine and fluorine atoms, as well as a piperidine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of halogen substituents can influence its reactivity and lipophilicity, affecting how it interacts with biological targets. Additionally, the piperidine group may enhance its pharmacological properties, potentially making it a candidate for various therapeutic applications. The compound's molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which are crucial for its solubility and stability in different environments. Overall, this compound's unique combination of functional groups and structural features makes it of interest in medicinal chemistry and drug development.

Formula: C₁₉H₁₉BrFNO

InChI: InChI=1/C19H19BrFNO/c20-15-8-9-17(18(21)12-15)19(23)16-7-3-2-6-14(16)13-22-10-4-1-5-11-22/h2-3,6-9,12H,1,4-5,10-11,13H2

SMILES: C1CCN(CC1)Cc1ccccc1C(=O)c1ccc(cc1F)Br