CAS 898773-59-6

Methanone, (2-chloro-4-fluorophenyl)[2-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (2-chloro-4-fluorophenyl)[2-(1-piperidinylmethyl)phenyl]- is a synthetic organic compound characterized by its complex structure, which includes a methanone functional group, a piperidine moiety, and halogen substituents. The presence of a chloro and a fluoro group on the phenyl rings contributes to its unique chemical reactivity and potential biological activity. This compound is typically categorized as a ketone due to the carbonyl group (C=O) in its structure. Its molecular framework suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar structures often exhibit significant biological properties. The piperidine ring enhances its lipophilicity, potentially improving its ability to cross biological membranes. Additionally, the specific arrangement of substituents can influence its pharmacokinetic and pharmacodynamic profiles. As with many synthetic compounds, safety and handling precautions are essential, and its effects on human health and the environment should be thoroughly evaluated in research contexts.

Formula: C₁₉H₁₉ClFNO

InChI: InChI=1S/C19H19ClFNO/c20-18-12-15(21)8-9-17(18)19(23)16-7-3-2-6-14(16)13-22-10-4-1-5-11-22/h2-3,6-9,12H,1,4-5,10-11,13H2

InChI key: InChIKey=GMUXAHGCQFFDFP-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=C(Cl)C=C(F)C=C2)C=CC=C1)N3CCCCC3

Synonyms:

• 2-Chloro-4-fluoro-2′-piperidinomethyl benzophenone
• Methanone, (2-chloro-4-fluorophenyl)[2-(1-piperidinylmethyl)phenyl]-