CAS 898773-61-0

Methanone, (3-chloro-5-fluorophenyl)[2-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (3-chloro-5-fluorophenyl)[2-(1-piperidinylmethyl)phenyl]- is a synthetic organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a chloro and a fluoro substituent on the phenyl rings contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. The piperidinylmethyl group suggests that the compound may exhibit pharmacological properties, possibly interacting with biological targets in a manner similar to other compounds containing piperidine moieties. This compound is likely to be a solid at room temperature, with moderate solubility in organic solvents, and may exhibit stability under standard laboratory conditions. Its specific applications could range from medicinal chemistry to research in material science, depending on its biological activity and interaction with other chemical entities. As with many synthetic compounds, safety data and handling precautions should be considered, particularly regarding its potential toxicity and environmental impact.

Formula: C₁₉H₁₉ClFNO

InChI: InChI=1S/C19H19ClFNO/c20-16-10-15(11-17(21)12-16)19(23)18-7-3-2-6-14(18)13-22-8-4-1-5-9-22/h2-3,6-7,10-12H,1,4-5,8-9,13H2

InChI key: InChIKey=PCJRZCVYBQHYIT-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCCCC2)C=CC=C1)C3=CC(Cl)=CC(F)=C3

Synonyms:

• Methanone, (3-chloro-5-fluorophenyl)[2-(1-piperidinylmethyl)phenyl]-

3′-Chloro-5′-fluoro-2-piperidinomethyl benzophenone

CAS: 898773-61-0

Formula: C₁₉H₁₉ClFNO

Purity: 97.0%

Molecular weight: 331.82

Ref: 10-F205203