CAS 898773-63-2

Methanone, (4-chloro-2-fluorophenyl)[2-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (4-chloro-2-fluorophenyl)[2-(1-piperidinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a piperidine moiety suggests potential biological activity, as piperidine derivatives are often found in pharmaceuticals. The specific halogen substitutions, namely the chloro and fluoro groups, can significantly influence the compound's reactivity, solubility, and interaction with biological targets. This compound is likely to exhibit lipophilic properties due to its aromatic components, which may affect its pharmacokinetics and bioavailability. Additionally, the presence of both chlorine and fluorine atoms can enhance the stability and metabolic resistance of the molecule. As with many synthetic organic compounds, safety and handling precautions are essential, given the potential toxicity associated with halogenated compounds. Overall, this compound's unique structural features may contribute to its utility in medicinal chemistry and drug development.

Formula: C₁₉H₁₉ClFNO

InChI: InChI=1S/C19H19ClFNO/c20-15-8-9-17(18(21)12-15)19(23)16-7-3-2-6-14(16)13-22-10-4-1-5-11-22/h2-3,6-9,12H,1,4-5,10-11,13H2

InChI key: InChIKey=REWJDBLAUVVKSG-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=C(F)C=C(Cl)C=C2)C=CC=C1)N3CCCCC3

Synonyms:

• (4-Chloro-2-fluorophenyl)[2-(1-piperidinylmethyl)phenyl]methanone
• Methanone, (4-chloro-2-fluorophenyl)[2-(1-piperidinylmethyl)phenyl]-

4-Chloro-2-fluoro-2′-piperidinomethyl benzophenone

CAS: 898773-63-2

Formula: C₁₉H₁₉ClFNO

Purity: 97.0%

Molecular weight: 331.82

Ref: 10-F205204