CymitQuimica logo

CAS 898773-67-6

:

(2,4-dichlorophenyl)-[2-(1-piperidylmethyl)phenyl]methanone

Description:
(2,4-Dichlorophenyl)-[2-(1-piperidylmethyl)phenyl]methanone, with CAS number 898773-67-6, is a synthetic organic compound characterized by its complex molecular structure, which includes a dichlorophenyl group and a piperidylmethyl substituent. This compound typically exhibits properties associated with its functional groups, such as potential lipophilicity due to the aromatic rings and the presence of chlorine atoms, which can influence its reactivity and biological activity. The piperidine ring contributes to its potential pharmacological properties, making it of interest in medicinal chemistry. The compound may exhibit various biological activities, including potential effects on the central nervous system, depending on its specific interactions with biological targets. Its synthesis and characterization involve standard organic chemistry techniques, and it may be utilized in research related to drug development or as a chemical probe in biological studies. Safety and handling precautions should be observed due to the presence of chlorine, which can pose environmental and health risks.
Formula:C19H19Cl2NO
InChI:InChI=1/C19H19Cl2NO/c20-15-8-9-17(18(21)12-15)19(23)16-7-3-2-6-14(16)13-22-10-4-1-5-11-22/h2-3,6-9,12H,1,4-5,10-11,13H2
SMILES:C1CCN(CC1)Cc1ccccc1C(=O)c1ccc(cc1Cl)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.