CAS 898773-69-8

Methanone, (2,5-dichlorophenyl)[2-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (2,5-dichlorophenyl)[2-(1-piperidinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the dichlorophenyl group indicates that the compound has two chlorine atoms substituted on a phenyl ring, which can influence its reactivity and biological activity. The piperidinylmethyl group suggests that the compound may exhibit properties associated with piperidine derivatives, potentially impacting its pharmacological profile. This compound may be of interest in medicinal chemistry, particularly for its potential applications in drug development. Its molecular structure contributes to its physical and chemical properties, such as solubility, melting point, and stability, which are essential for understanding its behavior in various environments. Additionally, the presence of halogen atoms often enhances lipophilicity, which can affect the compound's interaction with biological systems. Overall, this compound exemplifies the complexity and diversity of organic molecules used in research and industry.

Formula: C₁₉H₁₉Cl₂NO

InChI: InChI=1S/C19H19Cl2NO/c20-15-8-9-18(21)17(12-15)19(23)16-7-3-2-6-14(16)13-22-10-4-1-5-11-22/h2-3,6-9,12H,1,4-5,10-11,13H2

InChI key: InChIKey=HTGCTWAQPOJPHO-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=C(Cl)C=CC(Cl)=C2)C=CC=C1)N3CCCCC3

Synonyms:

• 2,5-Dichloro-2′-piperidinomethyl benzophenone
• Methanone, (2,5-dichlorophenyl)[2-(1-piperidinylmethyl)phenyl]-
• (2,5-Dichlorophenyl)[2-(1-piperidinylmethyl)phenyl]methanone

2,5-dichloro-2′-piperidinomethyl benzophenone

CAS: 898773-69-8

Formula: C₁₉H₁₉Cl₂NO

Purity: 97.0%

Molecular weight: 348.27

Ref: 10-F205207