CAS 898773-71-2

(3,4-dichlorophenyl)-[2-(1-piperidylmethyl)phenyl]methanone

Description:

(3,4-Dichlorophenyl)-[2-(1-piperidylmethyl)phenyl]methanone, identified by its CAS number 898773-71-2, is a synthetic organic compound characterized by its complex structure, which includes a dichlorophenyl group and a piperidylmethyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the dichlorophenyl moiety suggests that it may possess significant lipophilicity, influencing its solubility and permeability in biological systems. The piperidine ring can impart basicity, potentially allowing for interactions with various biological targets, such as receptors or enzymes. As a ketone, it may also participate in various chemical reactions, including nucleophilic attacks or reductions. The compound's specific applications and effects would depend on its interaction with biological systems, making it of interest in medicinal chemistry and pharmacology. However, detailed studies would be necessary to fully elucidate its properties, mechanisms of action, and potential therapeutic uses.

Formula: C₁₉H₁₉Cl₂NO

InChI: InChI=1/C19H19Cl2NO/c20-17-9-8-14(12-18(17)21)19(23)16-7-3-2-6-15(16)13-22-10-4-1-5-11-22/h2-3,6-9,12H,1,4-5,10-11,13H2

SMILES: C1CCN(CC1)Cc1ccccc1C(=O)c1ccc(c(c1)Cl)Cl