CAS 898773-73-4

Methanone, (3,5-dichlorophenyl)[2-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (3,5-dichlorophenyl)[2-(1-piperidinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 3,5-dichlorophenyl group indicates that chlorine atoms are substituted at the 3 and 5 positions of a phenyl ring, contributing to the compound's reactivity and potential biological activity. The piperidinylmethyl group suggests that the compound may exhibit properties associated with piperidine derivatives, such as potential interactions with neurotransmitter systems. This compound is likely to be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that may influence its pharmacological properties. Additionally, the presence of halogen substituents can enhance lipophilicity and affect the compound's solubility and permeability. Overall, Methanone, (3,5-dichlorophenyl)[2-(1-piperidinylmethyl)phenyl]- represents a class of compounds that may have significant implications in drug design and development.

Formula: C₁₉H₁₉Cl₂NO

InChI: InChI=1S/C19H19Cl2NO/c20-16-10-15(11-17(21)12-16)19(23)18-7-3-2-6-14(18)13-22-8-4-1-5-9-22/h2-3,6-7,10-12H,1,4-5,8-9,13H2

InChI key: InChIKey=LHBZQVSUTPVNMR-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCCCC2)C=CC=C1)C3=CC(Cl)=CC(Cl)=C3

Synonyms:

• 3,5-Dichloro-2′-piperidinomethyl benzophenone
• (3,5-Dichlorophenyl)[2-(1-piperidinylmethyl)phenyl]methanone
• Methanone, (3,5-dichlorophenyl)[2-(1-piperidinylmethyl)phenyl]-

3,5-dichloro-2′-piperidinomethyl benzophenone

CAS: 898773-73-4

Formula: C₁₉H₁₉Cl₂NO

Purity: 97.0%

Molecular weight: 348.27

Ref: 10-F205209