CAS 898773-75-6
:(2,4-difluorophenyl)-[2-(1-piperidylmethyl)phenyl]methanone
Description:
(2,4-Difluorophenyl)-[2-(1-piperidylmethyl)phenyl]methanone, identified by its CAS number 898773-75-6, is a synthetic organic compound characterized by its complex structure, which includes a difluorophenyl group and a piperidylmethyl substituent. This compound typically exhibits properties associated with aromatic ketones, such as moderate to high lipophilicity due to the presence of multiple aromatic rings. The difluorophenyl moiety contributes to its electronic properties, potentially enhancing its reactivity and interaction with biological targets. The piperidine ring adds to its pharmacological profile, often influencing its binding affinity and selectivity in biological systems. As a result, compounds of this nature may be investigated for their potential therapeutic applications, particularly in fields such as medicinal chemistry and drug development. Additionally, the presence of fluorine atoms can enhance metabolic stability and bioavailability. Overall, this compound exemplifies the intricate relationship between molecular structure and biological activity, making it a subject of interest in chemical research.
Formula:C19H19F2NO
InChI:InChI=1/C19H19F2NO/c20-15-8-9-17(18(21)12-15)19(23)16-7-3-2-6-14(16)13-22-10-4-1-5-11-22/h2-3,6-9,12H,1,4-5,10-11,13H2
SMILES:C1CCN(CC1)Cc1ccccc1C(=O)c1ccc(cc1F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.