CAS 898773-79-0

Methanone, (3,5-difluorophenyl)[2-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (3,5-difluorophenyl)[2-(1-piperidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 3,5-difluorophenyl group indicates that the compound has two fluorine atoms substituted on a phenyl ring, which can influence its electronic properties and reactivity. The piperidinylmethyl substituent suggests that the compound may exhibit biological activity, potentially interacting with various biological targets due to the piperidine ring's ability to engage in hydrogen bonding and other interactions. This compound is likely to be a solid at room temperature, with moderate solubility in organic solvents, reflecting its aromatic nature. Its molecular structure may confer specific pharmacological properties, making it of interest in medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of fluorine, which can affect toxicity and environmental impact.

Formula: C₁₉H₁₉F₂NO

InChI: InChI=1S/C19H19F2NO/c20-16-10-15(11-17(21)12-16)19(23)18-7-3-2-6-14(18)13-22-8-4-1-5-9-22/h2-3,6-7,10-12H,1,4-5,8-9,13H2

InChI key: InChIKey=BLTFKBJMEPPAMA-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCCCC2)C=CC=C1)C3=CC(F)=CC(F)=C3

Synonyms:

• Methanone, (3,5-difluorophenyl)[2-(1-piperidinylmethyl)phenyl]-
• 3′,5′-Difluoro-2-piperidinomethyl benzophenone
• (3,5-Difluorophenyl)[2-(1-piperidinylmethyl)phenyl]methanone

3′,5′-difluoro-2-piperidinomethyl benzophenone

CAS: 898773-79-0

Formula: C₁₉H₁₉F₂NO

Purity: 97.0%

Molecular weight: 315.364

Ref: 10-F205212