CymitQuimica logo

CAS 898773-83-6

:

cyclopropyl-[2-(1-piperidylmethyl)phenyl]methanone

Description:
Cyclopropyl-[2-(1-piperidylmethyl)phenyl]methanone, identified by its CAS number 898773-83-6, is a chemical compound characterized by its unique structural features. It contains a cyclopropyl group, which is a three-membered carbon ring known for its strain and reactivity, attached to a phenyl ring that is further substituted with a piperidylmethyl group. The presence of the piperidine moiety, a six-membered nitrogen-containing ring, contributes to the compound's potential biological activity, often enhancing its interaction with various biological targets. This compound is typically studied in the context of medicinal chemistry, where its structural attributes may influence pharmacological properties such as potency and selectivity. Additionally, the methanone functional group indicates the presence of a carbonyl, which can participate in various chemical reactions, making it a versatile building block in organic synthesis. Overall, the combination of these structural elements suggests that cyclopropyl-[2-(1-piperidylmethyl)phenyl]methanone may exhibit interesting chemical behavior and potential applications in drug development.
Formula:C16H21NO
InChI:InChI=1/C16H21NO/c18-16(13-8-9-13)15-7-3-2-6-14(15)12-17-10-4-1-5-11-17/h2-3,6-7,13H,1,4-5,8-12H2
SMILES:C1CCN(CC1)Cc1ccccc1C(=O)C1CC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.