CymitQuimica logo

CAS 898773-87-0

:

Cyclopentyl[2-(1-piperidinylmethyl)phenyl]methanone

Description:
Cyclopentyl[2-(1-piperidinylmethyl)phenyl]methanone, with the CAS number 898773-87-0, is a chemical compound characterized by its unique structure that includes a cyclopentyl group, a piperidine moiety, and a phenyl ring. This compound typically exhibits properties associated with ketones, such as being a potential solvent and having a distinctive odor. Its molecular structure suggests it may engage in various chemical interactions, making it of interest in medicinal chemistry and drug development. The presence of the piperidine ring indicates potential biological activity, as piperidine derivatives are often explored for their pharmacological properties. Additionally, the compound's lipophilicity may influence its solubility and permeability, which are critical factors in drug design. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Overall, Cyclopentyl[2-(1-piperidinylmethyl)phenyl]methanone represents a complex organic molecule with potential applications in various fields, including pharmaceuticals.
Formula:C18H25NO
InChI:InChI=1S/C18H25NO/c20-18(15-8-2-3-9-15)17-11-5-4-10-16(17)14-19-12-6-1-7-13-19/h4-5,10-11,15H,1-3,6-9,12-14H2
InChI key:InChIKey=MKFOWKYMNPSRGA-UHFFFAOYSA-N
SMILES:C(C1=C(C(=O)C2CCCC2)C=CC=C1)N3CCCCC3
Synonyms:
  • Methanone, cyclopentyl[2-(1-piperidinylmethyl)phenyl]-
  • Cyclopentyl[2-(1-piperidinylmethyl)phenyl]methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.