CAS 898773-91-6

Ethyl γ-oxo-2-(1-piperidinylmethyl)benzenebutanoate

Description:

Ethyl γ-oxo-2-(1-piperidinylmethyl)benzenebutanoate, identified by its CAS number 898773-91-6, is a chemical compound that belongs to the class of esters and contains both aromatic and aliphatic components. Its structure features a piperidine ring, which contributes to its potential biological activity, and a benzenebutanoate moiety that suggests it may have applications in medicinal chemistry. The presence of the γ-oxo group indicates that it may participate in various chemical reactions, such as condensation or nucleophilic attacks. This compound is likely to exhibit moderate solubility in organic solvents due to its ester functional group and aromatic characteristics. Additionally, the piperidine ring may impart specific pharmacological properties, making it of interest in drug development. As with many organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is handled, including temperature, pH, and the presence of other reactive species.

Formula: C₁₈H₂₅NO₃

InChI: InChI=1S/C18H25NO3/c1-2-22-18(21)11-10-17(20)16-9-5-4-8-15(16)14-19-12-6-3-7-13-19/h4-5,8-9H,2-3,6-7,10-14H2,1H3

InChI key: InChIKey=ZCHIRWCVPHTAFY-UHFFFAOYSA-N

SMILES: C(CCC(OCC)=O)(=O)C1=C(CN2CCCCC2)C=CC=C1

Synonyms:

• Benzenebutanoic acid, γ-oxo-2-(1-piperidinylmethyl)-, ethyl ester
• Ethyl γ-oxo-2-(1-piperidinylmethyl)benzenebutanoate

ethyl 4-oxo-4-[2-(piperidinomethyl)phenyl]butyrate

CAS: 898773-91-6

Formula: C₁₈H₂₅NO₃

Purity: 97.0%

Molecular weight: 303.402

Ref: 10-F205218