CAS 898773-95-0

Ethyl ε-oxo-2-(1-piperidinylmethyl)benzenehexanoate

Description:

Ethyl ε-oxo-2-(1-piperidinylmethyl)benzenehexanoate, identified by its CAS number 898773-95-0, is a chemical compound that features a complex structure combining an ethyl ester with a piperidine moiety. This compound typically exhibits characteristics common to esters, such as being a colorless to pale yellow liquid with a pleasant odor. Its molecular structure includes a benzene ring, which contributes to its aromatic properties, and a hexanoate chain that enhances its solubility in organic solvents. The presence of the piperidine group suggests potential biological activity, as piperidine derivatives are often associated with pharmacological effects. Ethyl ε-oxo-2-(1-piperidinylmethyl)benzenehexanoate may be utilized in various applications, including medicinal chemistry and organic synthesis, although specific uses would depend on its reactivity and biological interactions. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.

Formula: C₂₀H₂₉NO₃

InChI: InChI=1S/C20H29NO3/c1-2-24-20(23)13-7-6-12-19(22)18-11-5-4-10-17(18)16-21-14-8-3-9-15-21/h4-5,10-11H,2-3,6-9,12-16H2,1H3

InChI key: InChIKey=FGUVOSAUHACKOL-UHFFFAOYSA-N

SMILES: C(C1=C(C(CCCCC(OCC)=O)=O)C=CC=C1)N2CCCCC2

Synonyms:

• Benzenehexanoic acid, ε-oxo-2-(1-piperidinylmethyl)-, ethyl ester
• Ethyl ε-oxo-2-(1-piperidinylmethyl)benzenehexanoate

ethyl 6-oxo-6-[2-(piperidinomethyl)phenyl]hexanoate

CAS: 898773-95-0

Formula: C₂₀H₂₉NO₃

Purity: 97.0%

Molecular weight: 331.456

Ref: 10-F205220