CAS 898773-99-4
:Ethyl η-oxo-2-(1-piperidinylmethyl)benzeneoctanoate
Description:
Ethyl η-oxo-2-(1-piperidinylmethyl)benzeneoctanoate, identified by its CAS number 898773-99-4, is a chemical compound that features a complex structure incorporating both an ethyl ester and a piperidine moiety. This compound is characterized by its functional groups, which include an ester linkage and a ketone, contributing to its potential reactivity and solubility properties. The presence of the piperidine ring suggests that it may exhibit basic properties and could participate in various chemical reactions, including nucleophilic substitutions. Additionally, the aromatic benzene ring contributes to the compound's stability and may influence its interactions with biological systems. Ethyl η-oxo-2-(1-piperidinylmethyl)benzeneoctanoate may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. However, specific data regarding its physical properties, such as melting point, boiling point, and solubility, would require further investigation or experimental determination.
Formula:C22H33NO3
InChI:InChI=1/C22H33NO3/c1-2-26-22(25)15-7-4-3-6-14-21(24)20-13-9-8-12-19(20)18-23-16-10-5-11-17-23/h8-9,12-13H,2-7,10-11,14-18H2,1H3
InChI key:InChIKey=SBXMTKVGZWOAND-UHFFFAOYSA-N
SMILES:C(CCCCCCC(OCC)=O)(=O)C1=C(CN2CCCCC2)C=CC=C1
Synonyms:- Ethyl η-oxo-2-(1-piperidinylmethyl)benzeneoctanoate
- Benzeneoctanoic acid, η-oxo-2-(1-piperidinylmethyl)-, ethyl ester
- ETHYL 8-OXO-8-[2-(PIPERIDINOMETHYL)PHENYL]OCTANOATE
- Ethyl 8-oxo-8-(2-(piperidin-1-ylmethyl)phenyl)octanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.