CAS 898774-02-2

Methanone, (2-methylphenyl)[2-(1-pyrrolidinylmethyl)phenyl]-

Description:

Methanone, (2-methylphenyl)[2-(1-pyrrolidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two aromatic rings. The presence of a pyrrolidine moiety indicates that it has potential applications in medicinal chemistry, particularly in the development of psychoactive substances or pharmaceuticals. This compound is likely to exhibit moderate to high lipophilicity due to its aromatic and aliphatic components, which can influence its solubility and bioavailability. The presence of the methyl group on one of the phenyl rings may affect its electronic properties and steric hindrance, potentially impacting its reactivity and interaction with biological targets. Additionally, the compound's molecular structure suggests it may engage in various intermolecular interactions, such as hydrogen bonding and π-π stacking, which are significant in determining its physical and chemical behavior. Overall, this compound's unique features make it a subject of interest in both synthetic and medicinal chemistry research.

Formula: C₁₉H₂₁NO

InChI: InChI=1S/C19H21NO/c1-15-8-2-4-10-17(15)19(21)18-11-5-3-9-16(18)14-20-12-6-7-13-20/h2-5,8-11H,6-7,12-14H2,1H3

InChI key: InChIKey=OFIXJMOLZYKWTO-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=C(C)C=CC=C2)C=CC=C1)N3CCCC3

Synonyms:

• (2-Methylphenyl)[2-(1-pyrrolidinylmethyl)phenyl]methanone
• Methanone, (2-methylphenyl)[2-(1-pyrrolidinylmethyl)phenyl]-