CAS 898774-05-5

m-tolyl-[2-(pyrrolidin-1-ylmethyl)phenyl]methanone

Description:

m-Tolyl-[2-(pyrrolidin-1-ylmethyl)phenyl]methanone, with the CAS number 898774-05-5, is a chemical compound characterized by its complex structure, which includes a tolyl group and a pyrrolidine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. The presence of the pyrrolidine ring suggests that it may engage in various interactions, such as hydrogen bonding and dipole-dipole interactions, which can influence its biological activity and solubility in different solvents. Additionally, the methanone functional group indicates that it may participate in nucleophilic addition reactions. The compound's unique structure may also confer specific pharmacological properties, making it of interest in medicinal chemistry. However, detailed studies would be necessary to fully elucidate its physical and chemical properties, as well as its potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₁₉H₂₁NO

InChI: InChI=1/C19H21NO/c1-15-7-6-9-16(13-15)19(21)18-10-3-2-8-17(18)14-20-11-4-5-12-20/h2-3,6-10,13H,4-5,11-12,14H2,1H3

SMILES: Cc1cccc(c1)C(=O)c1ccccc1CN1CCCC1

3′-methyl-2-pyrrolidinomethyl benzophenone

CAS: 898774-05-5

Formula: C₁₉H₂₁NO

Purity: 97.0%

Molecular weight: 279.383

Ref: 10-F205225