CAS 898774-08-8

Methanone, (4-methylphenyl)[2-(1-pyrrolidinylmethyl)phenyl]-

Description:

Methanone, (4-methylphenyl)[2-(1-pyrrolidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two aromatic rings. The presence of a pyrrolidine moiety suggests that it may exhibit properties typical of both aromatic compounds and cyclic amines. This compound is likely to be a solid at room temperature, given the presence of multiple aromatic systems that typically enhance stability and melting points. Its molecular structure indicates potential for interactions such as hydrogen bonding and π-π stacking due to the aromatic rings. The presence of the pyrrolidine group may also impart certain pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's solubility characteristics would depend on the balance between its hydrophobic aromatic regions and the more polar pyrrolidine group. Overall, this compound may have applications in various fields, including pharmaceuticals, due to its unique structural features.

Formula: C₁₉H₂₁NO

InChI: InChI=1S/C19H21NO/c1-15-8-10-16(11-9-15)19(21)18-7-3-2-6-17(18)14-20-12-4-5-13-20/h2-3,6-11H,4-5,12-14H2,1H3

InChI key: InChIKey=UMADWEQSCMGTCY-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCCC2)C=CC=C1)C3=CC=C(C)C=C3

Synonyms:

• (4-Methylphenyl)[2-(1-pyrrolidinylmethyl)phenyl]methanone
• 4′-Methyl-2-pyrrolidinomethyl benzophenone
• Methanone, (4-methylphenyl)[2-(1-pyrrolidinylmethyl)phenyl]-

4′-methyl-2-pyrrolidinomethyl benzophenone

CAS: 898774-08-8

Formula: C₁₉H₂₁NO

Purity: 97.0%

Molecular weight: 279.383

Ref: 10-F205226