CAS 898774-16-8

1-(3,5-difluorophenyl)-3-(2-methoxyphenyl)propan-1-one

Description:

1-(3,5-Difluorophenyl)-3-(2-methoxyphenyl)propan-1-one, with the CAS number 898774-16-8, is an organic compound characterized by its unique structure that includes a propanone backbone substituted with a 3,5-difluorophenyl group and a 2-methoxyphenyl group. This compound typically exhibits properties associated with ketones, such as being a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is likely to be soluble in organic solvents like ethanol and dichloromethane, while being less soluble in water due to its hydrophobic aromatic groups. The presence of fluorine atoms can enhance its lipophilicity and influence its reactivity, making it of interest in medicinal chemistry and material science. Additionally, the methoxy group may contribute to its electronic properties, potentially affecting its interaction with biological targets. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.

Formula: C₁₆H₁₄F₂O₂

InChI: InChI=1/C16H14F2O2/c1-20-16-5-3-2-4-11(16)6-7-15(19)12-8-13(17)10-14(18)9-12/h2-5,8-10H,6-7H2,1H3

SMILES: COc1ccccc1CCC(=O)c1cc(cc(c1)F)F