CAS 898774-19-1

1-Propanone, 3-(2-methoxyphenyl)-1-(3,4,5-trifluorophenyl)-

Description:

1-Propanone, 3-(2-methoxyphenyl)-1-(3,4,5-trifluorophenyl)-, also known by its CAS number 898774-19-1, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a methoxyphenyl group and a trifluorophenyl group. The presence of the methoxy group enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. The trifluorophenyl group introduces significant electronegativity, potentially affecting the compound's electronic properties and stability. This compound may exhibit interesting chemical behavior due to the combination of electron-donating and electron-withdrawing groups, which can influence its reactivity in various chemical reactions. Additionally, its unique structure may impart specific biological activities, making it of interest in pharmaceutical research. Overall, 1-Propanone, 3-(2-methoxyphenyl)-1-(3,4,5-trifluorophenyl)- is a complex molecule with potential applications in various fields, including medicinal chemistry and materials science.

Formula: C₁₆H₁₃F₃O₂

InChI: InChI=1S/C16H13F3O2/c1-21-15-5-3-2-4-10(15)6-7-14(20)11-8-12(17)16(19)13(18)9-11/h2-5,8-9H,6-7H2,1H3

InChI key: InChIKey=KELDQKMEOAZGGO-UHFFFAOYSA-N

SMILES: C(CCC1=C(OC)C=CC=C1)(=O)C2=CC(F)=C(F)C(F)=C2

Synonyms:

• 1-Propanone, 3-(2-methoxyphenyl)-1-(3,4,5-trifluorophenyl)-
• 3-(2-Methoxyphenyl)-1-(3,4,5-trifluorophenyl)-1-propanone
• 3-(2-Methoxyphenyl)-3′,4′,5′-trifluoropropiophenone