CAS 898774-20-4

2-[2-(1-Pyrrolidinylmethyl)benzoyl]benzonitrile

Description:

2-[2-(1-Pyrrolidinylmethyl)benzoyl]benzonitrile, with the CAS number 898774-20-4, is a chemical compound characterized by its complex structure, which includes a benzoyl group and a benzonitrile moiety. This compound features a pyrrolidine ring, contributing to its potential biological activity and interactions. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of both the benzoyl and benzonitrile functional groups suggests that it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions. Additionally, the pyrrolidine component may influence its pharmacological properties, making it of interest in medicinal chemistry. The compound's molecular structure allows for potential applications in drug development, particularly in the design of agents targeting specific biological pathways. As with many organic compounds, its stability, reactivity, and interactions with other substances can vary based on environmental factors such as pH and temperature.

Formula: C₁₉H₁₈N₂O

InChI: InChI=1S/C19H18N2O/c20-13-15-7-1-3-9-17(15)19(22)18-10-4-2-8-16(18)14-21-11-5-6-12-21/h1-4,7-10H,5-6,11-12,14H2

InChI key: InChIKey=IJBBLFJXOWXCGO-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCCC2)C=CC=C1)C3=C(C#N)C=CC=C3

Synonyms:

• 2-[2-(1-Pyrrolidinylmethyl)benzoyl]benzonitrile
• Benzonitrile, 2-[2-(1-pyrrolidinylmethyl)benzoyl]-

2-cyano-2′-pyrrolidinomethyl benzophenone

CAS: 898774-20-4

Formula: C₁₉H₁₈N₂O

Purity: 97.0%

Molecular weight: 290.366

Ref: 10-F205230