CAS 898774-23-7

3-[2-(1-Pyrrolidinylmethyl)benzoyl]benzonitrile

Description:

3-[2-(1-Pyrrolidinylmethyl)benzoyl]benzonitrile, with the CAS number 898774-23-7, is a chemical compound characterized by its complex structure that includes a benzoyl group and a benzonitrile moiety. This compound features a pyrrolidine ring, which contributes to its potential biological activity and solubility properties. The presence of the nitrile functional group indicates that it may exhibit polar characteristics, influencing its interactions in various chemical environments. The compound is likely to be a solid at room temperature, with potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its structural motifs that may interact with biological targets. Its synthesis and characterization would typically involve standard organic chemistry techniques, including NMR and mass spectrometry for confirmation of structure. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with its use.

Formula: C₁₉H₁₈N₂O

InChI: InChI=1S/C19H18N2O/c20-13-15-6-5-8-16(12-15)19(22)18-9-2-1-7-17(18)14-21-10-3-4-11-21/h1-2,5-9,12H,3-4,10-11,14H2

InChI key: InChIKey=UCOXMCLAYLFYTD-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=CC(C#N)=CC=C2)C=CC=C1)N3CCCC3

Synonyms:

• Benzonitrile, 3-[2-(1-pyrrolidinylmethyl)benzoyl]-
• 3-[2-(1-Pyrrolidinylmethyl)benzoyl]benzonitrile

3′-cyano-2-pyrrolidinomethyl benzophenone

CAS: 898774-23-7

Formula: C₁₉H₁₈N₂O

Purity: 97.0%

Molecular weight: 290.366

Ref: 10-F205231