CAS 898774-26-0

4-[2-(1-Pyrrolidinylmethyl)benzoyl]benzonitrile

Description:

4-[2-(1-Pyrrolidinylmethyl)benzoyl]benzonitrile, with the CAS number 898774-26-0, is a chemical compound characterized by its complex structure, which includes a benzoyl group and a benzonitrile moiety. This compound features a pyrrolidine ring, which contributes to its potential biological activity and solubility properties. Typically, compounds of this nature may exhibit properties such as moderate to high lipophilicity due to the aromatic rings, which can influence their interaction with biological membranes. The presence of the nitrile group may impart unique reactivity and stability characteristics, making it of interest in medicinal chemistry and drug development. Additionally, the compound's structure suggests potential for interactions with various biological targets, which could be explored in pharmacological studies. Overall, the characteristics of this compound make it a subject of interest for further research in the fields of organic chemistry and pharmacology.

Formula: C₁₉H₁₈N₂O

InChI: InChI=1S/C19H18N2O/c20-13-15-7-9-16(10-8-15)19(22)18-6-2-1-5-17(18)14-21-11-3-4-12-21/h1-2,5-10H,3-4,11-12,14H2

InChI key: InChIKey=REXBWDZEPYPRCA-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=CC=C(C#N)C=C2)C=CC=C1)N3CCCC3

Synonyms:

• Benzonitrile, 4-[2-(1-pyrrolidinylmethyl)benzoyl]-
• 4-[2-(1-Pyrrolidinylmethyl)benzoyl]benzonitrile

4′-cyano-2-pyrrolidinomethyl benzophenone

CAS: 898774-26-0

Formula: C₁₉H₁₈N₂O

Purity: 97.0%

Molecular weight: 290.366

Ref: 10-F205232