CAS 898774-34-0
:1-Cyclohexyl-3-(2-methoxyphenyl)-1-propanone
Description:
1-Cyclohexyl-3-(2-methoxyphenyl)-1-propanone, with the CAS number 898774-34-0, is an organic compound that belongs to the class of ketones. It features a cyclohexyl group and a methoxy-substituted phenyl group attached to a propanone backbone, which contributes to its unique chemical properties. This compound is typically characterized by its moderate polarity due to the presence of the ketone functional group, which can engage in hydrogen bonding and dipole-dipole interactions. Its structure suggests potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. The presence of the methoxy group may enhance its solubility in organic solvents and influence its reactivity. Additionally, the compound's stability and reactivity can be affected by the steric hindrance introduced by the cyclohexyl group. As with many organic compounds, safety and handling precautions should be observed, as it may pose health risks if ingested or inhaled.
Formula:C16H22O2
InChI:InChI=1/C16H22O2/c1-18-16-10-6-5-9-14(16)11-12-15(17)13-7-3-2-4-8-13/h5-6,9-10,13H,2-4,7-8,11-12H2,1H3
InChI key:InChIKey=IOPARXCZCIGMDN-UHFFFAOYSA-N
SMILES:C(CC(=O)C1CCCCC1)C2=C(OC)C=CC=C2
Synonyms:- 1-Cyclohexyl-3-(2-methoxyphenyl)-1-propanone
- 1-Propanone, 1-cyclohexyl-3-(2-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.