CAS 898774-38-4

(2-methylsulfanylphenyl)-[2-(pyrrolidin-1-ylmethyl)phenyl]methanone

Description:

The chemical substance known as (2-methylsulfanylphenyl)-[2-(pyrrolidin-1-ylmethyl)phenyl]methanone, with the CAS number 898774-38-4, is a synthetic organic compound characterized by its complex structure, which includes a ketone functional group and multiple aromatic rings. This compound features a methylsulfanyl group, which can influence its reactivity and solubility, as well as a pyrrolidine moiety that may contribute to its biological activity. The presence of these functional groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's molecular structure indicates it may exhibit specific interactions with biological targets, making it of interest for research in drug design. Additionally, its stability and solubility in various solvents can be influenced by the substituents on the aromatic rings. Overall, this compound represents a class of molecules that may have significant implications in therapeutic applications, although detailed studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₁₉H₂₁NOS

InChI: InChI=1/C19H21NOS/c1-22-18-11-5-4-10-17(18)19(21)16-9-3-2-8-15(16)14-20-12-6-7-13-20/h2-5,8-11H,6-7,12-14H2,1H3

SMILES: CSc1ccccc1C(=O)c1ccccc1CN1CCCC1