CAS 898774-43-1
:3-(3-methoxyphenyl)-1-(p-tolyl)propan-1-one
Description:
3-(3-Methoxyphenyl)-1-(p-tolyl)propan-1-one, identified by its CAS number 898774-43-1, is an organic compound that belongs to the class of ketones. It features a propanone backbone with two aromatic substituents: a methoxyphenyl group and a p-tolyl group. This compound is characterized by its relatively complex structure, which contributes to its potential applications in various fields, including pharmaceuticals and organic synthesis. The presence of the methoxy group enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. Additionally, the compound may exhibit interesting physical properties such as melting and boiling points, which are influenced by its molecular structure and intermolecular forces. As with many organic compounds, it is essential to handle it with care, considering safety data and potential hazards associated with its use. Overall, 3-(3-methoxyphenyl)-1-(p-tolyl)propan-1-one represents a valuable compound for research and development in organic chemistry.
Formula:C17H18O2
InChI:InChI=1/C17H18O2/c1-13-6-9-15(10-7-13)17(18)11-8-14-4-3-5-16(12-14)19-2/h3-7,9-10,12H,8,11H2,1-2H3
SMILES:Cc1ccc(cc1)C(=O)CCc1cccc(c1)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.