CAS 898774-44-2

Methanone, (3-bromophenyl)[2-(1-pyrrolidinylmethyl)phenyl]-

Description:

Methanone, (3-bromophenyl)[2-(1-pyrrolidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a bromine atom at the 3-position of one phenyl ring introduces halogen characteristics, influencing the compound's reactivity and physical properties. The pyrrolidine moiety contributes to the compound's potential biological activity, as pyrrolidine derivatives are often associated with various pharmacological effects. This compound is likely to exhibit moderate solubility in organic solvents due to its aromatic nature, while its polar functional groups may enhance solubility in polar solvents. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, given the presence of both aromatic and nitrogen-containing groups. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of the bromine atom, which can pose health risks. Overall, this compound represents a unique combination of structural features that may be of interest in chemical research and development.

Formula: C₁₈H₁₈BrNO

InChI: InChI=1S/C18H18BrNO/c19-16-8-5-7-14(12-16)18(21)17-9-2-1-6-15(17)13-20-10-3-4-11-20/h1-2,5-9,12H,3-4,10-11,13H2

InChI key: InChIKey=HHFOIBBKCQNJSJ-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=CC(Br)=CC=C2)C=CC=C1)N3CCCC3

Synonyms:

• Methanone, (3-bromophenyl)[2-(1-pyrrolidinylmethyl)phenyl]-
• 3′-Bromo-2-pyrrolidinomethyl benzophenone
• (3-Bromophenyl)[2-(1-pyrrolidinylmethyl)phenyl]methanone

3′-bromo-2-pyrrolidinomethyl benzophenone

CAS: 898774-44-2

Formula: C₁₈H₁₈BrNO

Purity: 97.0%

Molecular weight: 344.252

Ref: 10-F205238