CAS 898774-50-0

(3-chlorophenyl)-[2-(pyrrolidin-1-ylmethyl)phenyl]methanone

Description:

The chemical substance known as (3-chlorophenyl)-[2-(pyrrolidin-1-ylmethyl)phenyl]methanone, with the CAS number 898774-50-0, is a synthetic organic compound characterized by its complex structure, which includes a chlorinated phenyl group and a pyrrolidine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the chlorophenyl group may enhance lipophilicity, influencing its solubility and interaction with biological membranes. The pyrrolidine ring suggests potential for interactions with neurotransmitter systems, making it of interest in pharmacological research. Additionally, the methanone functional group indicates the presence of a carbonyl, which can participate in various chemical reactions, including nucleophilic attacks. Overall, this compound's unique structural features may confer specific reactivity and biological properties, warranting further investigation in medicinal chemistry and related fields.

Formula: C₁₈H₁₈ClNO

InChI: InChI=1/C18H18ClNO/c19-16-8-5-7-14(12-16)18(21)17-9-2-1-6-15(17)13-20-10-3-4-11-20/h1-2,5-9,12H,3-4,10-11,13H2

SMILES: c1ccc(c(c1)CN1CCCC1)C(=O)c1cccc(c1)Cl

3′-chloro-2-pyrrolidinomethyl benzophenone

CAS: 898774-50-0

Formula: C₁₈H₁₈ClNO

Purity: 97.0%

Molecular weight: 299.8

Ref: 10-F205240