CAS 898774-52-2

3-[3-(3-Methoxyphenyl)-1-oxopropyl]benzonitrile

Description:

3-[3-(3-Methoxyphenyl)-1-oxopropyl]benzonitrile, with the CAS number 898774-52-2, is an organic compound characterized by its complex structure that includes a benzonitrile moiety and a propyl chain substituted with a methoxyphenyl group. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for various chemical reactions due to the presence of functional groups. The methoxy group enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. The nitrile functional group contributes to its polarity and can participate in nucleophilic addition reactions. Additionally, compounds like this may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The presence of multiple aromatic rings suggests potential for π-π stacking interactions, which can affect its physical properties, such as melting point and solubility. Overall, this compound's unique structure and functional groups make it a subject of interest for further research in various chemical and pharmaceutical applications.

Formula: C₁₇H₁₅NO₂

InChI: InChI=1S/C17H15NO2/c1-20-16-7-3-4-13(11-16)8-9-17(19)15-6-2-5-14(10-15)12-18/h2-7,10-11H,8-9H2,1H3

InChI key: InChIKey=KQZZVNGLPVIKQT-UHFFFAOYSA-N

SMILES: C(CCC1=CC(OC)=CC=C1)(=O)C2=CC(C#N)=CC=C2

Synonyms:

• Benzonitrile, 3-[3-(3-methoxyphenyl)-1-oxopropyl]-
• 3-[3-(3-Methoxyphenyl)-1-oxopropyl]benzonitrile

3′-cyano-3-(3-methoxyphenyl)propiophenone

CAS: 898774-52-2

Formula: C₁₇H₁₅NO₂

Purity: 97.0%

Molecular weight: 265.312

Ref: 10-F205837