CAS 898774-53-3

Methanone, (3-fluorophenyl)[2-(1-pyrrolidinylmethyl)phenyl]-

Description:

Methanone, (3-fluorophenyl)[2-(1-pyrrolidinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and two distinct aromatic rings. The presence of a fluorine atom on one of the phenyl rings contributes to its electronic properties, potentially influencing its reactivity and interaction with biological targets. The pyrrolidinylmethyl group indicates that the compound may exhibit certain pharmacological activities, as pyrrolidine derivatives are often associated with various biological effects. This compound is likely to be a solid at room temperature, with moderate solubility in organic solvents, reflecting its aromatic nature. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and aliphatic components that can interact with biological systems. As with many synthetic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound would need to be assessed through further research and testing.

Formula: C₁₈H₁₈FNO

InChI: InChI=1/C18H18FNO/c19-16-8-5-7-14(12-16)18(21)17-9-2-1-6-15(17)13-20-10-3-4-11-20/h1-2,5-9,12H,3-4,10-11,13H2

InChI key: InChIKey=GCLGJLLOTWUOQO-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=CC(F)=CC=C2)C=CC=C1)N3CCCC3

Synonyms:

• 3′-Fluoro-2-pyrrolidinomethyl benzophenone
• Methanone, (3-fluorophenyl)[2-(1-pyrrolidinylmethyl)phenyl]-
• (3-Fluorophenyl)[2-(1-pyrrolidinylmethyl)phenyl]methanone
• (3-Fluorophenyl)(2-(pyrrolidin-1-ylmethyl)phenyl)methanone

3′-fluoro-2-pyrrolidinomethyl benzophenone

CAS: 898774-53-3

Formula: C₁₈H₁₈FNO

Purity: 97.0%

Molecular weight: 283.346

Ref: 10-F205242